C6H7IN2OS — CID 114790937
4-ethylsulfanyl-5-iodo-1H-pyrimidin-6-one (PubChem CID 114790937) has the molecular formula C6H7IN2OS and a molecular weight of 282.11 g/mol. Its IUPAC name is 4-ethylsulfanyl-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-ethylsulfanyl-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114790937 |
| Molecular Formula | C6H7IN2OS |
| Molecular Weight | 282.11 g/mol |
| Exact Mass | 281.93 |
| IUPAC Name | 4-ethylsulfanyl-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCSc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C6H7IN2OS/c1-2-11-6-4(7)5(10)8-3-9-6/h3H,2H2,1H3,(H,8,9,10) |
| InChIKey | NSWDFGDTQJRWFM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.11 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|