C8H11BrN2OS — CID 114791095
5-bromo-4-butylsulfanyl-1H-pyrimidin-6-one (PubChem CID 114791095) has the molecular formula C8H11BrN2OS and a molecular weight of 263.16 g/mol. Its IUPAC name is 5-bromo-4-butylsulfanyl-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-butylsulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114791095 |
| Molecular Formula | C8H11BrN2OS |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 5-bromo-4-butylsulfanyl-1H-pyrimidin-6-one |
| SMILES | CCCCSc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C8H11BrN2OS/c1-2-3-4-13-8-6(9)7(12)10-5-11-8/h5H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | WTZZUCRIBJCVSA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|