C13H14ClN3S2 — CID 114793040
6-[(4-chlorophenyl)methylsulfanyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 114793040) has the molecular formula C13H14ClN3S2 and a molecular weight of 311.86 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methylsulfanyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-[(4-chlorophenyl)methylsulfanyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114793040 |
| Molecular Formula | C13H14ClN3S2 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 6-[(4-chlorophenyl)methylsulfanyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CNc1cc(SCc2ccc(Cl)cc2)nc(SC)n1 |
| InChI | InChI=1S/C13H14ClN3S2/c1-15-11-7-12(17-13(16-11)18-2)19-8-9-3-5-10(14)6-4-9/h3-7H,8H2,1-2H3,(H,15,16,17) |
| InChIKey | XXXCCVDFGZIRCH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |