C14H17N3O3S — CID 114795590
N'-hydroxy-3-[methyl(naphthalen-1-ylsulfonyl)amino]propanimidamide (PubChem CID 114795590) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is N'-hydroxy-3-[methyl(naphthalen-1-ylsulfonyl)amino]propanimidamide.
| Compound Name | N'-hydroxy-3-[methyl(naphthalen-1-ylsulfonyl)amino]propanimidamide |
|---|---|
| PubChem CID | 114795590 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N'-hydroxy-3-[methyl(naphthalen-1-ylsulfonyl)amino]propanimidamide |
| SMILES | CN(CC/C(N)=N/O)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H17N3O3S/c1-17(10-9-14(15)16-18)21(19,20)13-8-4-6-11-5-2-3-7-12(11)13/h2-8,18H,9-10H2,1H3,(H2,15,16) |
| InChIKey | VZDHLKZWQDPDDF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|