C11H18N2OS — CID 114796190
2-methyl-4-(2-pyrrolidin-3-ylethoxymethyl)-1,3-thiazole (PubChem CID 114796190) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-methyl-4-(2-pyrrolidin-3-ylethoxymethyl)-1,3-thiazole.
| Compound Name | 2-methyl-4-(2-pyrrolidin-3-ylethoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 114796190 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-methyl-4-(2-pyrrolidin-3-ylethoxymethyl)-1,3-thiazole |
| SMILES | Cc1nc(COCCC2CCNC2)cs1 |
| InChI | InChI=1S/C11H18N2OS/c1-9-13-11(8-15-9)7-14-5-3-10-2-4-12-6-10/h8,10,12H,2-7H2,1H3 |
| InChIKey | ZTBFPGUWUDJBRP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|