C33H16F12N4O2 — CID 11479644
2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-pyridin-4-yl-5-(trifluoromethyl)-1,3-oxazol-2-yl]phenyl]propan-2-yl]phenyl]-4-pyridin-4-yl-5-(trifluoromethyl)-1,3-oxazole (PubChem CID 11479644) has the molecular formula C33H16F12N4O2 and a molecular weight of 728.49 g/mol. Its IUPAC name is 2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-pyridin-4-yl-5-(trifluoromethyl)-1,3-oxazol-2-yl]phenyl]propan-2-yl]phenyl]-4-pyridin-4-yl-5-(trifluoromethyl)-1,3-oxazole.
| Compound Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-pyridin-4-yl-5-(trifluoromethyl)-1,3-oxazol-2-yl]phenyl]propan-2-yl]phenyl]-4-pyridin-4-yl-5-(trifluoromethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 11479644 |
| Molecular Formula | C33H16F12N4O2 |
| Molecular Weight | 728.49 g/mol |
| Exact Mass | 728.11 |
| IUPAC Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-pyridin-4-yl-5-(trifluoromethyl)-1,3-oxazol-2-yl]phenyl]propan-2-yl]phenyl]-4-pyridin-4-yl-5-(trifluoromethyl)-1,3-oxazole |
| SMILES | FC(F)(F)c1oc(-c2ccc(C(c3ccc(-c4nc(-c5ccncc5)c(C(F)(F)F)o4)cc3)(C(F)(F)F)C(F)(F)F)cc2)nc1-c1ccncc1 |
| InChI | InChI=1S/C33H16F12N4O2/c34-30(35,36)25-23(17-9-13-46-14-10-17)48-27(50-25)19-1-5-21(6-2-19)29(32(40,41)42,33(43,44)45)22-7-3-20(4-8-22)28-49-24(18-11-15-47-16-12-18)26(51-28)31(37,38)39/h1-16H |
| InChIKey | ZSKGNFLQPSMEBD-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.49 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |