C9H14N4O3 — CID 114796594
6-(2-pyrrolidin-3-ylethoxy)-2H-1,2,4-triazine-3,5-dione (PubChem CID 114796594) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 6-(2-pyrrolidin-3-ylethoxy)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(2-pyrrolidin-3-ylethoxy)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 114796594 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 6-(2-pyrrolidin-3-ylethoxy)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(OCCC2CCNC2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H14N4O3/c14-7-8(12-13-9(15)11-7)16-4-2-6-1-3-10-5-6/h6,10H,1-5H2,(H2,11,13,14,15) |
| InChIKey | MPAMMFJDVMLLSS-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |