C12H18N2O2S — CID 114796719
(4-amino-5-methylthiophen-2-yl)-[3-(2-hydroxyethyl)pyrrolidin-1-yl]methanone (PubChem CID 114796719) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is (4-amino-5-methylthiophen-2-yl)-[3-(2-hydroxyethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-amino-5-methylthiophen-2-yl)-[3-(2-hydroxyethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 114796719 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (4-amino-5-methylthiophen-2-yl)-[3-(2-hydroxyethyl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1sc(C(=O)N2CCC(CCO)C2)cc1N |
| InChI | InChI=1S/C12H18N2O2S/c1-8-10(13)6-11(17-8)12(16)14-4-2-9(7-14)3-5-15/h6,9,15H,2-5,7,13H2,1H3 |
| InChIKey | CUPBDCQCOLYZHN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |