About 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine
3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine (PubChem CID 114800590) has the molecular formula C10H17ClF3N
and a molecular weight of 243.70 g/mol. Its IUPAC name is 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine.
Molecular Properties
| Compound Name | 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine |
| PubChem CID | 114800590 |
| Molecular Formula | C10H17ClF3N |
| Molecular Weight | 243.70 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine |
| SMILES | FC(F)(F)CCCN1CCC(CCCl)C1 |
| InChI | InChI=1S/C10H17ClF3N/c11-5-2-9-3-7-15(8-9)6-1-4-10(12,13)14/h9H,1-8H2 |
| InChIKey | HWGMTXAKBNOVSP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.70 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine?
The IUPAC name of 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine (CID 114800590) is 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine.
What is the SMILES notation for 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine?
The canonical SMILES for 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine is FC(F)(F)CCCN1CCC(CCCl)C1.
What is the InChIKey of 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine?
The InChIKey is HWGMTXAKBNOVSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClF3N/c11-5-2-9-3-7-15(8-9)6-1-4-10(12,13)14/h9H,1-8H2.
What are the key properties of 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine?
3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine has a molecular weight of 243.70 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)pyrrolidine is sourced from PubChem (CID 114800590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).