C17H20N2OS — CID 114803063
2-(oxan-3-yl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3-thiazole (PubChem CID 114803063) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 2-(oxan-3-yl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3-thiazole.
| Compound Name | 2-(oxan-3-yl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 114803063 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-(oxan-3-yl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3-thiazole |
| SMILES | c1cc2c(cc1-c1csc(C3CCCOC3)n1)CCNC2 |
| InChI | InChI=1S/C17H20N2OS/c1-2-15(10-20-7-1)17-19-16(11-21-17)13-3-4-14-9-18-6-5-12(14)8-13/h3-4,8,11,15,18H,1-2,5-7,9-10H2 |
| InChIKey | KYGMANDHIYKRJA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |