About 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide
4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide (PubChem CID 114803176) has the molecular formula C13H21N3O2S
and a molecular weight of 283.40 g/mol. Its IUPAC name is 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide.
Molecular Properties
| Compound Name | 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide |
| PubChem CID | 114803176 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)N1CCC(N)c2ccccc21 |
| InChI | InChI=1S/C13H21N3O2S/c1-13(2,3)15-19(17,18)16-9-8-11(14)10-6-4-5-7-12(10)16/h4-7,11,15H,8-9,14H2,1-3H3 |
| InChIKey | WDNNFKIRHKJZTE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide?
The IUPAC name of 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide (CID 114803176) is 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide.
What is the SMILES notation for 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide?
The canonical SMILES for 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide is CC(C)(C)NS(=O)(=O)N1CCC(N)c2ccccc21.
What is the InChIKey of 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide?
The InChIKey is WDNNFKIRHKJZTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2S/c1-13(2,3)15-19(17,18)16-9-8-11(14)10-6-4-5-7-12(10)16/h4-7,11,15H,8-9,14H2,1-3H3.
What are the key properties of 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide?
4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide has a molecular weight of 283.40 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-tert-butyl-3,4-dihydro-2H-quinoline-1-sulfonamide is sourced from PubChem (CID 114803176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).