C8H18F3N3O2S — CID 114803669
2-ethyl-2-N-(2,2,2-trifluoroethylsulfamoyl)butane-1,2-diamine (PubChem CID 114803669) has the molecular formula C8H18F3N3O2S and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-ethyl-2-N-(2,2,2-trifluoroethylsulfamoyl)butane-1,2-diamine.
| Compound Name | 2-ethyl-2-N-(2,2,2-trifluoroethylsulfamoyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 114803669 |
| Molecular Formula | C8H18F3N3O2S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-ethyl-2-N-(2,2,2-trifluoroethylsulfamoyl)butane-1,2-diamine |
| SMILES | CCC(CC)(CN)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H18F3N3O2S/c1-3-7(4-2,5-12)14-17(15,16)13-6-8(9,10)11/h13-14H,3-6,12H2,1-2H3 |
| InChIKey | MNIUZAMTOCWGOA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |