C10H20F3N3O2S — CID 114803675
1-cyclohexyl-N-(2,2,2-trifluoroethylsulfamoyl)ethane-1,2-diamine (PubChem CID 114803675) has the molecular formula C10H20F3N3O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is 1-cyclohexyl-N-(2,2,2-trifluoroethylsulfamoyl)ethane-1,2-diamine.
| Compound Name | 1-cyclohexyl-N-(2,2,2-trifluoroethylsulfamoyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114803675 |
| Molecular Formula | C10H20F3N3O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-cyclohexyl-N-(2,2,2-trifluoroethylsulfamoyl)ethane-1,2-diamine |
| SMILES | NCC(NS(=O)(=O)NCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H20F3N3O2S/c11-10(12,13)7-15-19(17,18)16-9(6-14)8-4-2-1-3-5-8/h8-9,15-16H,1-7,14H2 |
| InChIKey | JXPFCZZRTLABEH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |