C11H25N3O2S — CID 114803918
[[3-(aminomethyl)pentan-3-yl-ethylsulfamoyl]amino]cyclopropane (PubChem CID 114803918) has the molecular formula C11H25N3O2S and a molecular weight of 263.41 g/mol. Its IUPAC name is [[3-(aminomethyl)pentan-3-yl-ethylsulfamoyl]amino]cyclopropane.
| Compound Name | [[3-(aminomethyl)pentan-3-yl-ethylsulfamoyl]amino]cyclopropane |
|---|---|
| PubChem CID | 114803918 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | [[3-(aminomethyl)pentan-3-yl-ethylsulfamoyl]amino]cyclopropane |
| SMILES | CCN(C(CC)(CC)CN)S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C11H25N3O2S/c1-4-11(5-2,9-12)14(6-3)17(15,16)13-10-7-8-10/h10,13H,4-9,12H2,1-3H3 |
| InChIKey | LCPLFAXXUFQZEW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |