C6H14F3N3O2S — CID 114803954
N'-(2,2,2-trifluoroethylsulfamoyl)butane-1,4-diamine (PubChem CID 114803954) has the molecular formula C6H14F3N3O2S and a molecular weight of 249.26 g/mol. Its IUPAC name is N'-(2,2,2-trifluoroethylsulfamoyl)butane-1,4-diamine.
| Compound Name | N'-(2,2,2-trifluoroethylsulfamoyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 114803954 |
| Molecular Formula | C6H14F3N3O2S |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | N'-(2,2,2-trifluoroethylsulfamoyl)butane-1,4-diamine |
| SMILES | NCCCCNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H14F3N3O2S/c7-6(8,9)5-12-15(13,14)11-4-2-1-3-10/h11-12H,1-5,10H2 |
| InChIKey | OCVJSKYKBIMSIS-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|