C7H16F3N3O2S — CID 114804049
3-methyl-2-N-(2,2,2-trifluoroethylsulfamoyl)butane-1,2-diamine (PubChem CID 114804049) has the molecular formula C7H16F3N3O2S and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-methyl-2-N-(2,2,2-trifluoroethylsulfamoyl)butane-1,2-diamine.
| Compound Name | 3-methyl-2-N-(2,2,2-trifluoroethylsulfamoyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 114804049 |
| Molecular Formula | C7H16F3N3O2S |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-methyl-2-N-(2,2,2-trifluoroethylsulfamoyl)butane-1,2-diamine |
| SMILES | CC(C)C(CN)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H16F3N3O2S/c1-5(2)6(3-11)13-16(14,15)12-4-7(8,9)10/h5-6,12-13H,3-4,11H2,1-2H3 |
| InChIKey | HRBDSTYNJHDOKD-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |