C12H18F3N3O2S — CID 114804120
2-(aminomethyl)-N-(tert-butylsulfamoyl)-4-(trifluoromethyl)aniline (PubChem CID 114804120) has the molecular formula C12H18F3N3O2S and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(tert-butylsulfamoyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-(aminomethyl)-N-(tert-butylsulfamoyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 114804120 |
| Molecular Formula | C12H18F3N3O2S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-(aminomethyl)-N-(tert-butylsulfamoyl)-4-(trifluoromethyl)aniline |
| SMILES | CC(C)(C)NS(=O)(=O)Nc1ccc(C(F)(F)F)cc1CN |
| InChI | InChI=1S/C12H18F3N3O2S/c1-11(2,3)18-21(19,20)17-10-5-4-9(12(13,14)15)6-8(10)7-16/h4-6,17-18H,7,16H2,1-3H3 |
| InChIKey | CGPAZINPRIUTFC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |