C12H20N4O3S — CID 114804431
2-[(3-aminophenyl)methyl-(propylsulfamoyl)amino]acetamide (PubChem CID 114804431) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[(3-aminophenyl)methyl-(propylsulfamoyl)amino]acetamide.
| Compound Name | 2-[(3-aminophenyl)methyl-(propylsulfamoyl)amino]acetamide |
|---|---|
| PubChem CID | 114804431 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-[(3-aminophenyl)methyl-(propylsulfamoyl)amino]acetamide |
| SMILES | CCCNS(=O)(=O)N(CC(N)=O)Cc1cccc(N)c1 |
| InChI | InChI=1S/C12H20N4O3S/c1-2-6-15-20(18,19)16(9-12(14)17)8-10-4-3-5-11(13)7-10/h3-5,7,15H,2,6,8-9,13H2,1H3,(H2,14,17) |
| InChIKey | XJYHUABQXGSPEY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|