C12H16N4O2S — CID 114804992
5-N-(propylsulfamoyl)quinoline-5,8-diamine (PubChem CID 114804992) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 5-N-(propylsulfamoyl)quinoline-5,8-diamine.
| Compound Name | 5-N-(propylsulfamoyl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 114804992 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-N-(propylsulfamoyl)quinoline-5,8-diamine |
| SMILES | CCCNS(=O)(=O)Nc1ccc(N)c2ncccc12 |
| InChI | InChI=1S/C12H16N4O2S/c1-2-7-15-19(17,18)16-11-6-5-10(13)12-9(11)4-3-8-14-12/h3-6,8,15-16H,2,7,13H2,1H3 |
| InChIKey | VIZYFQFHWVKBFZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|