About 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine
4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine (PubChem CID 114805025) has the molecular formula C11H22F3N3O2S
and a molecular weight of 317.38 g/mol. Its IUPAC name is 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine.
Molecular Properties
| Compound Name | 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine |
| PubChem CID | 114805025 |
| Molecular Formula | C11H22F3N3O2S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine |
| SMILES | CC(C)(C)NS(=O)(=O)N(CC(F)(F)F)C1CCNCC1 |
| InChI | InChI=1S/C11H22F3N3O2S/c1-10(2,3)16-20(18,19)17(8-11(12,13)14)9-4-6-15-7-5-9/h9,15-16H,4-8H2,1-3H3 |
| InChIKey | ZSTJCCMAZSPQAU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine?
The IUPAC name of 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine (CID 114805025) is 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine.
What is the SMILES notation for 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine?
The canonical SMILES for 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine is CC(C)(C)NS(=O)(=O)N(CC(F)(F)F)C1CCNCC1.
What is the InChIKey of 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine?
The InChIKey is ZSTJCCMAZSPQAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F3N3O2S/c1-10(2,3)16-20(18,19)17(8-11(12,13)14)9-4-6-15-7-5-9/h9,15-16H,4-8H2,1-3H3.
What are the key properties of 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine?
4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine has a molecular weight of 317.38 g/mol, XLogP of 1.24, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[tert-butylsulfamoyl(2,2,2-trifluoroethyl)amino]piperidine is sourced from PubChem (CID 114805025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).