About 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane
2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane (PubChem CID 11480539) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane.
Molecular Properties
| Compound Name | 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane |
| PubChem CID | 11480539 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane |
| SMILES | C1=CCC(CCC2CO2)=CC1 |
| InChI | InChI=1S/C10H14O/c1-2-4-9(5-3-1)6-7-10-8-11-10/h1-2,5,10H,3-4,6-8H2 |
| InChIKey | HPDMAIXTYVLJIP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane?
The IUPAC name of 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane (CID 11480539) is 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane.
What is the SMILES notation for 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane?
The canonical SMILES for 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane is C1=CCC(CCC2CO2)=CC1.
What is the InChIKey of 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane?
The InChIKey is HPDMAIXTYVLJIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-2-4-9(5-3-1)6-7-10-8-11-10/h1-2,5,10H,3-4,6-8H2.
What are the key properties of 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane?
2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane has a molecular weight of 150.22 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclohexa-1,4-dien-1-ylethyl)oxirane is sourced from PubChem (CID 11480539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).