C9H17F3N2O4S — CID 114805545
4-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]butanoic acid (PubChem CID 114805545) has the molecular formula C9H17F3N2O4S and a molecular weight of 306.31 g/mol. Its IUPAC name is 4-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]butanoic acid.
| Compound Name | 4-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 114805545 |
| Molecular Formula | C9H17F3N2O4S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O4S/c1-7(2)14(5-3-4-8(15)16)19(17,18)13-6-9(10,11)12/h7,13H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | FTRDQJYPHJHGKP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |