C10H20O — CID 11480574
(2S,3S)-2,3,6-trimethylhept-5-en-1-ol (PubChem CID 11480574) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is (2S,3S)-2,3,6-trimethylhept-5-en-1-ol.
| Compound Name | (2S,3S)-2,3,6-trimethylhept-5-en-1-ol |
|---|---|
| PubChem CID | 11480574 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (2S,3S)-2,3,6-trimethylhept-5-en-1-ol |
| SMILES | CC(C)=CC[C@H](C)[C@H](C)CO |
| InChI | InChI=1S/C10H20O/c1-8(2)5-6-9(3)10(4)7-11/h5,9-11H,6-7H2,1-4H3/t9-,10+/m0/s1 |
| InChIKey | NEFLTGMRGQSVHM-VHSXEESVSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|