C11H23N3O4S — CID 114805953
2-[4-(tert-butylsulfamoyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 114805953) has the molecular formula C11H23N3O4S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-[4-(tert-butylsulfamoyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(tert-butylsulfamoyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 114805953 |
| Molecular Formula | C11H23N3O4S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[4-(tert-butylsulfamoyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | CC(C)(C)NS(=O)(=O)N1CCCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C11H23N3O4S/c1-11(2,3)12-19(17,18)14-6-4-5-13(7-8-14)9-10(15)16/h12H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | NKJHPYSHYIQMRZ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |