C7H7F3N4O4S — CID 114806100
3-(2,2,2-trifluoroethylsulfamoylamino)pyrazine-2-carboxylic acid (PubChem CID 114806100) has the molecular formula C7H7F3N4O4S and a molecular weight of 300.22 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethylsulfamoylamino)pyrazine-2-carboxylic acid.
| Compound Name | 3-(2,2,2-trifluoroethylsulfamoylamino)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 114806100 |
| Molecular Formula | C7H7F3N4O4S |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 3-(2,2,2-trifluoroethylsulfamoylamino)pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1nccnc1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H7F3N4O4S/c8-7(9,10)3-13-19(17,18)14-5-4(6(15)16)11-1-2-12-5/h1-2,13H,3H2,(H,12,14)(H,15,16) |
| InChIKey | CMPLUQUQRXSGPI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |