C10H14O2 — CID 11480647
(3aS,6R,7R,7aS)-6,7-dimethyl-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 11480647) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (3aS,6R,7R,7aS)-6,7-dimethyl-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | (3aS,6R,7R,7aS)-6,7-dimethyl-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 11480647 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (3aS,6R,7R,7aS)-6,7-dimethyl-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | C[C@H]1[C@@H]2C(=O)OC[C@H]2C=C[C@H]1C |
| InChI | InChI=1S/C10H14O2/c1-6-3-4-8-5-12-10(11)9(8)7(6)2/h3-4,6-9H,5H2,1-2H3/t6-,7-,8-,9+/m1/s1 |
| InChIKey | CHALWYDEGBGOJG-BGZDPUMWSA-N |
| XLogP | 1.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|