About N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine
N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine (PubChem CID 114807265) has the molecular formula C6H11F3N2O2S
and a molecular weight of 232.23 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine.
Molecular Properties
| Compound Name | N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine |
| PubChem CID | 114807265 |
| Molecular Formula | C6H11F3N2O2S |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine |
| SMILES | C=CCCNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H11F3N2O2S/c1-2-3-4-10-14(12,13)11-5-6(7,8)9/h2,10-11H,1,3-5H2 |
| InChIKey | LHQPITGQLMNGQL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine?
The IUPAC name of N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine (CID 114807265) is N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine.
What is the SMILES notation for N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine?
The canonical SMILES for N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine is C=CCCNS(=O)(=O)NCC(F)(F)F.
What is the InChIKey of N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine?
The InChIKey is LHQPITGQLMNGQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F3N2O2S/c1-2-3-4-10-14(12,13)11-5-6(7,8)9/h2,10-11H,1,3-5H2.
What are the key properties of N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine?
N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine has a molecular weight of 232.23 g/mol, XLogP of 0.55, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2,2-trifluoroethylsulfamoyl)but-3-en-1-amine is sourced from PubChem (CID 114807265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).