C12H19N3O2S — CID 114807428
N-(propan-2-ylsulfamoyl)-1,2,3,4-tetrahydroquinolin-5-amine (PubChem CID 114807428) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-(propan-2-ylsulfamoyl)-1,2,3,4-tetrahydroquinolin-5-amine.
| Compound Name | N-(propan-2-ylsulfamoyl)-1,2,3,4-tetrahydroquinolin-5-amine |
|---|---|
| PubChem CID | 114807428 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(propan-2-ylsulfamoyl)-1,2,3,4-tetrahydroquinolin-5-amine |
| SMILES | CC(C)NS(=O)(=O)Nc1cccc2c1CCCN2 |
| InChI | InChI=1S/C12H19N3O2S/c1-9(2)14-18(16,17)15-12-7-3-6-11-10(12)5-4-8-13-11/h3,6-7,9,13-15H,4-5,8H2,1-2H3 |
| InChIKey | XOIUPTSHCDBRQH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |