C11H18F3N3O2S — CID 114807746
1-(2,2,2-trifluoroethylsulfamoylamino)cyclooctane-1-carbonitrile (PubChem CID 114807746) has the molecular formula C11H18F3N3O2S and a molecular weight of 313.35 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethylsulfamoylamino)cyclooctane-1-carbonitrile.
| Compound Name | 1-(2,2,2-trifluoroethylsulfamoylamino)cyclooctane-1-carbonitrile |
|---|---|
| PubChem CID | 114807746 |
| Molecular Formula | C11H18F3N3O2S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-(2,2,2-trifluoroethylsulfamoylamino)cyclooctane-1-carbonitrile |
| SMILES | N#CC1(NS(=O)(=O)NCC(F)(F)F)CCCCCCC1 |
| InChI | InChI=1S/C11H18F3N3O2S/c12-11(13,14)9-16-20(18,19)17-10(8-15)6-4-2-1-3-5-7-10/h16-17H,1-7,9H2 |
| InChIKey | YBVVTWGTQNHLAZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |