About 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane
2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane (PubChem CID 114807778) has the molecular formula C6H10F3N3O2S
and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane.
Molecular Properties
| Compound Name | 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane |
| PubChem CID | 114807778 |
| Molecular Formula | C6H10F3N3O2S |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane |
| SMILES | CCN(CC#N)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H10F3N3O2S/c1-2-12(4-3-10)15(13,14)11-5-6(7,8)9/h11H,2,4-5H2,1H3 |
| InChIKey | AGZKKXKAPPQEGW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane?
The IUPAC name of 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane (CID 114807778) is 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane.
What is the SMILES notation for 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane?
The canonical SMILES for 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane is CCN(CC#N)S(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane?
The InChIKey is AGZKKXKAPPQEGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F3N3O2S/c1-2-12(4-3-10)15(13,14)11-5-6(7,8)9/h11H,2,4-5H2,1H3.
What are the key properties of 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane?
2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane has a molecular weight of 245.23 g/mol, XLogP of 0.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[cyanomethyl(ethyl)sulfamoyl]amino]-1,1,1-trifluoroethane is sourced from PubChem (CID 114807778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).