About 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile
3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile (PubChem CID 114807835) has the molecular formula C5H8F3N3O2S
and a molecular weight of 231.20 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile.
Molecular Properties
| Compound Name | 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile |
| PubChem CID | 114807835 |
| Molecular Formula | C5H8F3N3O2S |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile |
| SMILES | N#CCCNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C5H8F3N3O2S/c6-5(7,8)4-11-14(12,13)10-3-1-2-9/h10-11H,1,3-4H2 |
| InChIKey | WZCISGJZGNGHDS-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile?
The IUPAC name of 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile (CID 114807835) is 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile.
What is the SMILES notation for 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile?
The canonical SMILES for 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile is N#CCCNS(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile?
The InChIKey is WZCISGJZGNGHDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F3N3O2S/c6-5(7,8)4-11-14(12,13)10-3-1-2-9/h10-11H,1,3-4H2.
What are the key properties of 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile?
3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile has a molecular weight of 231.20 g/mol, XLogP of -0.11, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile is sourced from PubChem (CID 114807835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).