About 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile
5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile (PubChem CID 114807939) has the molecular formula C7H12F3N3O2S
and a molecular weight of 259.25 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile.
Molecular Properties
| Compound Name | 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile |
| PubChem CID | 114807939 |
| Molecular Formula | C7H12F3N3O2S |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile |
| SMILES | N#CCCCCNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H12F3N3O2S/c8-7(9,10)6-13-16(14,15)12-5-3-1-2-4-11/h12-13H,1-3,5-6H2 |
| InChIKey | ALSHIUPFOACPFQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile?
The IUPAC name of 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile (CID 114807939) is 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile.
What is the SMILES notation for 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile?
The canonical SMILES for 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile is N#CCCCCNS(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile?
The InChIKey is ALSHIUPFOACPFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3N3O2S/c8-7(9,10)6-13-16(14,15)12-5-3-1-2-4-11/h12-13H,1-3,5-6H2.
What are the key properties of 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile?
5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile has a molecular weight of 259.25 g/mol, XLogP of 0.67, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2,2-trifluoroethylsulfamoylamino)pentanenitrile is sourced from PubChem (CID 114807939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).