C7H17N3O2S2 — CID 114808111
2-methyl-2-(propan-2-ylsulfamoylamino)propanethioamide (PubChem CID 114808111) has the molecular formula C7H17N3O2S2 and a molecular weight of 239.37 g/mol. Its IUPAC name is 2-methyl-2-(propan-2-ylsulfamoylamino)propanethioamide.
| Compound Name | 2-methyl-2-(propan-2-ylsulfamoylamino)propanethioamide |
|---|---|
| PubChem CID | 114808111 |
| Molecular Formula | C7H17N3O2S2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-methyl-2-(propan-2-ylsulfamoylamino)propanethioamide |
| SMILES | CC(C)NS(=O)(=O)NC(C)(C)C(N)=S |
| InChI | InChI=1S/C7H17N3O2S2/c1-5(2)9-14(11,12)10-7(3,4)6(8)13/h5,9-10H,1-4H3,(H2,8,13) |
| InChIKey | FAKDRPYPWALCCB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|