About 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide
3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide (PubChem CID 114808225) has the molecular formula C8H14F3N3O2S2
and a molecular weight of 305.35 g/mol. Its IUPAC name is 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide.
Molecular Properties
| Compound Name | 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide |
| PubChem CID | 114808225 |
| Molecular Formula | C8H14F3N3O2S2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide |
| SMILES | NC(=S)CCN(C1CC1)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O2S2/c9-8(10,11)5-13-18(15,16)14(6-1-2-6)4-3-7(12)17/h6,13H,1-5H2,(H2,12,17) |
| InChIKey | ONCSYVRPHBLHAV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide?
The IUPAC name of 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide (CID 114808225) is 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide.
What is the SMILES notation for 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide?
The canonical SMILES for 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide is NC(=S)CCN(C1CC1)S(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide?
The InChIKey is ONCSYVRPHBLHAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3N3O2S2/c9-8(10,11)5-13-18(15,16)14(6-1-2-6)4-3-7(12)17/h6,13H,1-5H2,(H2,12,17).
What are the key properties of 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide?
3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide has a molecular weight of 305.35 g/mol, XLogP of 0.52, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide is sourced from PubChem (CID 114808225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).