C10H21N3O2S2 — CID 114808330
2-(tert-butylsulfamoylamino)cyclopentane-1-carbothioamide (PubChem CID 114808330) has the molecular formula C10H21N3O2S2 and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-(tert-butylsulfamoylamino)cyclopentane-1-carbothioamide.
| Compound Name | 2-(tert-butylsulfamoylamino)cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 114808330 |
| Molecular Formula | C10H21N3O2S2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-(tert-butylsulfamoylamino)cyclopentane-1-carbothioamide |
| SMILES | CC(C)(C)NS(=O)(=O)NC1CCCC1C(N)=S |
| InChI | InChI=1S/C10H21N3O2S2/c1-10(2,3)13-17(14,15)12-8-6-4-5-7(8)9(11)16/h7-8,12-13H,4-6H2,1-3H3,(H2,11,16) |
| InChIKey | ZVBIUMYYSLSEOP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|