C9H17F3N4O2S2 — CID 114808368
2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]propanethioamide (PubChem CID 114808368) has the molecular formula C9H17F3N4O2S2 and a molecular weight of 334.39 g/mol. Its IUPAC name is 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]propanethioamide.
| Compound Name | 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]propanethioamide |
|---|---|
| PubChem CID | 114808368 |
| Molecular Formula | C9H17F3N4O2S2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]propanethioamide |
| SMILES | CC(C(N)=S)N1CCN(S(=O)(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H17F3N4O2S2/c1-7(8(13)19)15-2-4-16(5-3-15)20(17,18)14-6-9(10,11)12/h7,14H,2-6H2,1H3,(H2,13,19) |
| InChIKey | SHUXHUGPKQGGRC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|