About 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide
2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide (PubChem CID 114808374) has the molecular formula C10H19F3N4O2S2
and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide.
Molecular Properties
| Compound Name | 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide |
| PubChem CID | 114808374 |
| Molecular Formula | C10H19F3N4O2S2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide |
| SMILES | CCC(C(N)=S)N1CCN(S(=O)(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H19F3N4O2S2/c1-2-8(9(14)20)16-3-5-17(6-4-16)21(18,19)15-7-10(11,12)13/h8,15H,2-7H2,1H3,(H2,14,20) |
| InChIKey | SXRNYESDBLZFOR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide?
The IUPAC name of 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide (CID 114808374) is 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide.
What is the SMILES notation for 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide?
The canonical SMILES for 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide is CCC(C(N)=S)N1CCN(S(=O)(=O)NCC(F)(F)F)CC1.
What is the InChIKey of 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide?
The InChIKey is SXRNYESDBLZFOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N4O2S2/c1-2-8(9(14)20)16-3-5-17(6-4-16)21(18,19)15-7-10(11,12)13/h8,15H,2-7H2,1H3,(H2,14,20).
What are the key properties of 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide?
2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide has a molecular weight of 348.42 g/mol, XLogP of 0.07, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]butanethioamide is sourced from PubChem (CID 114808374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).