About 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide
2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide (PubChem CID 114808447) has the molecular formula C9H16F3N3O2S2
and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide.
Molecular Properties
| Compound Name | 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide |
| PubChem CID | 114808447 |
| Molecular Formula | C9H16F3N3O2S2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide |
| SMILES | NC(=S)CN(C1CCCC1)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H16F3N3O2S2/c10-9(11,12)6-14-19(16,17)15(5-8(13)18)7-3-1-2-4-7/h7,14H,1-6H2,(H2,13,18) |
| InChIKey | MACJAXJACUXHEY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide?
The IUPAC name of 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide (CID 114808447) is 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide.
What is the SMILES notation for 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide?
The canonical SMILES for 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide is NC(=S)CN(C1CCCC1)S(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide?
The InChIKey is MACJAXJACUXHEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3N3O2S2/c10-9(11,12)6-14-19(16,17)15(5-8(13)18)7-3-1-2-4-7/h7,14H,1-6H2,(H2,13,18).
What are the key properties of 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide?
2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide has a molecular weight of 319.37 g/mol, XLogP of 0.91, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopentyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide is sourced from PubChem (CID 114808447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).