About 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide
2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide (PubChem CID 114809046) has the molecular formula C7H14F3N3O2S
and a molecular weight of 261.27 g/mol. Its IUPAC name is 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide.
Molecular Properties
| Compound Name | 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide |
| PubChem CID | 114809046 |
| Molecular Formula | C7H14F3N3O2S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide |
| SMILES | NC1CCCCN1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H14F3N3O2S/c8-7(9,10)5-12-16(14,15)13-4-2-1-3-6(13)11/h6,12H,1-5,11H2 |
| InChIKey | YISLFYILPRGUFH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide?
The IUPAC name of 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide (CID 114809046) is 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide.
What is the SMILES notation for 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide?
The canonical SMILES for 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide is NC1CCCCN1S(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide?
The InChIKey is YISLFYILPRGUFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3N3O2S/c8-7(9,10)5-12-16(14,15)13-4-2-1-3-6(13)11/h6,12H,1-5,11H2.
What are the key properties of 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide?
2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide has a molecular weight of 261.27 g/mol, XLogP of 0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide is sourced from PubChem (CID 114809046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).