About 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol
3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol (PubChem CID 114809555) has the molecular formula C8H17F3N2O3S
and a molecular weight of 278.30 g/mol. Its IUPAC name is 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol.
Molecular Properties
| Compound Name | 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol |
| PubChem CID | 114809555 |
| Molecular Formula | C8H17F3N2O3S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H17F3N2O3S/c1-3-7(14,4-2)5-12-17(15,16)13-6-8(9,10)11/h12-14H,3-6H2,1-2H3 |
| InChIKey | IUKFTHGYEXKPFO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol?
The IUPAC name of 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol (CID 114809555) is 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol.
What is the SMILES notation for 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol?
The canonical SMILES for 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol is CCC(O)(CC)CNS(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol?
The InChIKey is IUKFTHGYEXKPFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F3N2O3S/c1-3-7(14,4-2)5-12-17(15,16)13-6-8(9,10)11/h12-14H,3-6H2,1-2H3.
What are the key properties of 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol?
3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol has a molecular weight of 278.30 g/mol, XLogP of 0.52, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,2,2-trifluoroethylsulfamoylamino)methyl]pentan-3-ol is sourced from PubChem (CID 114809555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).