About 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide
3-hydroxy-N,3-dipropylazetidine-1-sulfonamide (PubChem CID 114809622) has the molecular formula C9H20N2O3S
and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide.
Molecular Properties
| Compound Name | 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide |
| PubChem CID | 114809622 |
| Molecular Formula | C9H20N2O3S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide |
| SMILES | CCCNS(=O)(=O)N1CC(O)(CCC)C1 |
| InChI | InChI=1S/C9H20N2O3S/c1-3-5-9(12)7-11(8-9)15(13,14)10-6-4-2/h10,12H,3-8H2,1-2H3 |
| InChIKey | LNGJLGIGBDYSKV-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide?
The IUPAC name of 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide (CID 114809622) is 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide.
What is the SMILES notation for 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide?
The canonical SMILES for 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide is CCCNS(=O)(=O)N1CC(O)(CCC)C1.
What is the InChIKey of 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide?
The InChIKey is LNGJLGIGBDYSKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O3S/c1-3-5-9(12)7-11(8-9)15(13,14)10-6-4-2/h10,12H,3-8H2,1-2H3.
What are the key properties of 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide?
3-hydroxy-N,3-dipropylazetidine-1-sulfonamide has a molecular weight of 236.34 g/mol, XLogP of 0.08, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N,3-dipropylazetidine-1-sulfonamide is sourced from PubChem (CID 114809622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).