C8H16N2O3S — CID 114809632
3-cyclopropyl-N-ethyl-3-hydroxyazetidine-1-sulfonamide (PubChem CID 114809632) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is 3-cyclopropyl-N-ethyl-3-hydroxyazetidine-1-sulfonamide.
| Compound Name | 3-cyclopropyl-N-ethyl-3-hydroxyazetidine-1-sulfonamide |
|---|---|
| PubChem CID | 114809632 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 3-cyclopropyl-N-ethyl-3-hydroxyazetidine-1-sulfonamide |
| SMILES | CCNS(=O)(=O)N1CC(O)(C2CC2)C1 |
| InChI | InChI=1S/C8H16N2O3S/c1-2-9-14(12,13)10-5-8(11,6-10)7-3-4-7/h7,9,11H,2-6H2,1H3 |
| InChIKey | CNNMONSSOBGOTP-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |