C9H18N2O3S — CID 114809635
3-cyclopropyl-3-hydroxy-N-propylazetidine-1-sulfonamide (PubChem CID 114809635) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is 3-cyclopropyl-3-hydroxy-N-propylazetidine-1-sulfonamide.
| Compound Name | 3-cyclopropyl-3-hydroxy-N-propylazetidine-1-sulfonamide |
|---|---|
| PubChem CID | 114809635 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-cyclopropyl-3-hydroxy-N-propylazetidine-1-sulfonamide |
| SMILES | CCCNS(=O)(=O)N1CC(O)(C2CC2)C1 |
| InChI | InChI=1S/C9H18N2O3S/c1-2-5-10-15(13,14)11-6-9(12,7-11)8-3-4-8/h8,10,12H,2-7H2,1H3 |
| InChIKey | XTMFGWXSSWMKEK-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |