About 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol
4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol (PubChem CID 114809706) has the molecular formula C7H15F3N2O3S
and a molecular weight of 264.27 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol.
Molecular Properties
| Compound Name | 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol |
| PubChem CID | 114809706 |
| Molecular Formula | C7H15F3N2O3S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol |
| SMILES | CC(CCCO)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H15F3N2O3S/c1-6(3-2-4-13)12-16(14,15)11-5-7(8,9)10/h6,11-13H,2-5H2,1H3 |
| InChIKey | HEZUUZCSPSSMRX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol?
The IUPAC name of 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol (CID 114809706) is 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol.
What is the SMILES notation for 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol?
The canonical SMILES for 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol is CC(CCCO)NS(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol?
The InChIKey is HEZUUZCSPSSMRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F3N2O3S/c1-6(3-2-4-13)12-16(14,15)11-5-7(8,9)10/h6,11-13H,2-5H2,1H3.
What are the key properties of 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol?
4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol has a molecular weight of 264.27 g/mol, XLogP of 0.13, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol is sourced from PubChem (CID 114809706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).