About 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol
1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol (PubChem CID 114809806) has the molecular formula C6H13F3N2O3S
and a molecular weight of 250.24 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol.
Molecular Properties
| Compound Name | 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol |
| PubChem CID | 114809806 |
| Molecular Formula | C6H13F3N2O3S |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol |
| SMILES | CCC(O)CNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H13F3N2O3S/c1-2-5(12)3-10-15(13,14)11-4-6(7,8)9/h5,10-12H,2-4H2,1H3 |
| InChIKey | RMRGQCSSSAELAL-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol?
The IUPAC name of 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol (CID 114809806) is 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol.
What is the SMILES notation for 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol?
The canonical SMILES for 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol is CCC(O)CNS(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol?
The InChIKey is RMRGQCSSSAELAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F3N2O3S/c1-2-5(12)3-10-15(13,14)11-4-6(7,8)9/h5,10-12H,2-4H2,1H3.
What are the key properties of 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol?
1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol has a molecular weight of 250.24 g/mol, XLogP of -0.26, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol is sourced from PubChem (CID 114809806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).