About 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol
3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol (PubChem CID 114809810) has the molecular formula C7H15F3N2O3S
and a molecular weight of 264.27 g/mol. Its IUPAC name is 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol.
Molecular Properties
| Compound Name | 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol |
| PubChem CID | 114809810 |
| Molecular Formula | C7H15F3N2O3S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol |
| SMILES | CC(C)C(O)CNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H15F3N2O3S/c1-5(2)6(13)3-11-16(14,15)12-4-7(8,9)10/h5-6,11-13H,3-4H2,1-2H3 |
| InChIKey | SZKRLURMLXDLHM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol?
The IUPAC name of 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol (CID 114809810) is 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol.
What is the SMILES notation for 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol?
The canonical SMILES for 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol is CC(C)C(O)CNS(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol?
The InChIKey is SZKRLURMLXDLHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F3N2O3S/c1-5(2)6(13)3-11-16(14,15)12-4-7(8,9)10/h5-6,11-13H,3-4H2,1-2H3.
What are the key properties of 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol?
3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol has a molecular weight of 264.27 g/mol, XLogP of -0.01, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)butan-2-ol is sourced from PubChem (CID 114809810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).