C6H13NO6 — CID 11480996
(2R,3S,4S,5S,6R)-2-aminooxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 11480996) has the molecular formula C6H13NO6 and a molecular weight of 195.17 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-aminooxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-aminooxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11480996 |
| Molecular Formula | C6H13NO6 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-aminooxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | NO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO6/c7-13-6-5(11)4(10)3(9)2(1-8)12-6/h2-6,8-11H,1,7H2/t2-,3-,4+,5+,6-/m1/s1 |
| InChIKey | RHMWVNFRRRZAAQ-RWOPYEJCSA-N |
| XLogP | -3.32 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|