C4H6F3N5O2S — CID 114810084
N-(2,2,2-trifluoroethylsulfamoyl)-1H-1,2,4-triazol-5-amine (PubChem CID 114810084) has the molecular formula C4H6F3N5O2S and a molecular weight of 245.19 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethylsulfamoyl)-1H-1,2,4-triazol-5-amine.
| Compound Name | N-(2,2,2-trifluoroethylsulfamoyl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 114810084 |
| Molecular Formula | C4H6F3N5O2S |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | N-(2,2,2-trifluoroethylsulfamoyl)-1H-1,2,4-triazol-5-amine |
| SMILES | O=S(=O)(NCC(F)(F)F)Nc1ncn[nH]1 |
| InChI | InChI=1S/C4H6F3N5O2S/c5-4(6,7)1-10-15(13,14)12-3-8-2-9-11-3/h2,10H,1H2,(H2,8,9,11,12) |
| InChIKey | LWPHGADOCQFQPV-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |