About N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine
N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine (PubChem CID 114810087) has the molecular formula C5H9N5O2S
and a molecular weight of 203.23 g/mol. Its IUPAC name is N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine.
Molecular Properties
| Compound Name | N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine |
| PubChem CID | 114810087 |
| Molecular Formula | C5H9N5O2S |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine |
| SMILES | O=S(=O)(Nc1ncn[nH]1)NC1CC1 |
| InChI | InChI=1S/C5H9N5O2S/c11-13(12,9-4-1-2-4)10-5-6-3-7-8-5/h3-4,9H,1-2H2,(H2,6,7,8,10) |
| InChIKey | FSACLVDJWBQCCO-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine?
The IUPAC name of N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine (CID 114810087) is N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine.
What is the SMILES notation for N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine?
The canonical SMILES for N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine is O=S(=O)(Nc1ncn[nH]1)NC1CC1.
What is the InChIKey of N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine?
The InChIKey is FSACLVDJWBQCCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O2S/c11-13(12,9-4-1-2-4)10-5-6-3-7-8-5/h3-4,9H,1-2H2,(H2,6,7,8,10).
What are the key properties of N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine?
N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine has a molecular weight of 203.23 g/mol, XLogP of -0.79, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylsulfamoyl)-1H-1,2,4-triazol-5-amine is sourced from PubChem (CID 114810087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).