C21H26N2O4 — CID 1148101
phenyl-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 1148101) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is phenyl-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | phenyl-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 1148101 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | phenyl-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc(CN2CCN(C(=O)c3ccccc3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C21H26N2O4/c1-25-18-10-9-17(19(26-2)20(18)27-3)15-22-11-13-23(14-12-22)21(24)16-7-5-4-6-8-16/h4-10H,11-15H2,1-3H3 |
| InChIKey | DBZVLLZQEOTRLY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |